
CAS 15590-60-0
:Ammonium 2-ethylhexanoate
Description:
Ammonium 2-ethylhexanoate, with the CAS number 15590-60-0, is an organic compound that serves as a salt formed from the reaction of 2-ethylhexanoic acid and ammonium hydroxide. This substance typically appears as a white to off-white solid or crystalline powder. It is soluble in water, which makes it useful in various applications, including as a surfactant and emulsifying agent in the formulation of paints, coatings, and personal care products. The compound exhibits characteristics typical of ammonium salts, such as being hygroscopic, meaning it can absorb moisture from the air. Additionally, it may have a mild odor associated with its organic components. Ammonium 2-ethylhexanoate can also play a role in chemical synthesis and as a stabilizer in certain formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C8H16O2·H3N
InChI:InChI=1S/C8H16O2.H3N/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);1H3
InChI key:InChIKey=JQQFHYGWOCWHFI-UHFFFAOYSA-N
SMILES:C(CCCC)(C(O)=O)CC.N
Synonyms:- Ammonium 2-ethyl-n-hexanoate
- Ammonium ethylhexanoate
- Hexanoic acid, 2-ethyl-, ammonium salt
- Ammonium 2-ethylhexanoate
- Hexanoic acid, 2-ethyl-, ammonium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
