CAS 155905-80-9

1-(1,1-Dimethylethyl) 2-methyl 5,6-dihydro-1,2(4H)-pyridinedicarboxylate

Description:

1-(1,1-Dimethylethyl) 2-methyl 5,6-dihydro-1,2(4H)-pyridinedicarboxylate, with the CAS number 155905-80-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two carboxylate ester functional groups, contributing to its potential reactivity and solubility in various organic solvents. The presence of the tert-butyl group (1,1-dimethylethyl) and a methyl group enhances its steric bulk, which can influence its chemical behavior and interactions with other molecules. The dihydropyridine structure suggests that it may participate in redox reactions, making it of interest in organic synthesis and medicinal chemistry. Additionally, the compound's molecular configuration may impart specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Overall, this compound's unique structural features position it as a potentially valuable intermediate in chemical synthesis and research applications.

Formula: C₁₂H₁₉NO₄

InChI: InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-8-6-5-7-9(13)10(14)16-4/h7H,5-6,8H2,1-4H3

InChI key: InChIKey=HJZHZSUJUMWLFB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(C(OC)=O)=CCCC1

Synonyms:

• 1-(1,1-Dimethylethyl) 2-methyl 5,6-dihydro-1,2(4H)-pyridinedicarboxylate
• 1,2(4H)-Pyridinedicarboxylic acid, 5,6-dihydro-, 1-(1,1-dimethylethyl) 2-methyl ester
• 1-tert-Butyl 2-methyl 5,6-dihydropyridine-1,2(4H)-dicarboxylate