CAS 1559059-73-2

1-Pyrrolidineethanamine, 3-(2-methylphenyl)-, hydrochloride (1:2)

Description:

1-Pyrrolidineethanamine, 3-(2-methylphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and an ethylamine side chain, along with a 2-methylphenyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. The presence of the pyrrolidine moiety suggests potential biological activity, as pyrrolidine derivatives are often investigated for their pharmacological properties. The 2-methylphenyl group may influence the compound's lipophilicity and interaction with biological targets. As a hydrochloride salt, it is likely to exhibit good thermal stability and can be handled safely in laboratory settings. The compound's specific applications may vary, but it could be relevant in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its toxicity, pharmacokinetics, and specific uses would be necessary to fully understand its potential in research and industry.

Formula: C₁₃H₂₀N₂·2ClH

InChI: InChI=1S/C13H20N2.2ClH/c1-11-4-2-3-5-13(11)12-6-8-15(10-12)9-7-14;;/h2-5,12H,6-10,14H2,1H3;2*1H

InChI key: InChIKey=NKASEGJQKONAQE-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1)C2CN(CCN)CC2.Cl

Synonyms:

• 1-Pyrrolidineethanamine, 3-(2-methylphenyl)-, hydrochloride (1:2)

{2-[3-(2-methylphenyl)-1-pyrrolidinyl]ethyl}amine dihydrochloride

CAS: 1559059-73-2

Formula: C₁₃H₂₂Cl₂N₂

Purity: 95.0%

Molecular weight: 277.23

Ref: 10-F385889