CAS 1559059-75-4

Spiro[2.5]octane-1-methanamine, hydrochloride (1:1)

Description:

Spiro[2.5]octane-1-methanamine, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework with a nitrogen-containing amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The spiro structure contributes to its rigidity and may influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is often used in pharmaceutical applications, potentially serving as a precursor or intermediate in the synthesis of various bioactive molecules. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on its purity and the conditions under which it is handled. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance. Overall, Spiro[2.5]octane-1-methanamine, hydrochloride is of interest in both synthetic chemistry and medicinal chemistry contexts.

Formula: C₉H₁₇N·ClH

InChI: InChI=1S/C9H17N.ClH/c10-7-8-6-9(8)4-2-1-3-5-9;/h8H,1-7,10H2;1H

InChI key: InChIKey=KPEGWRREECZOKP-UHFFFAOYSA-N

SMILES: C(N)C1C2(C1)CCCCC2.Cl

Synonyms:

• Spiro[2.5]octane-1-methanamine, hydrochloride (1:1)

(spiro[2.5]oct-1-ylmethyl)amine hydrochloride

CAS: 1559059-75-4

Formula: C₉H₁₈ClN

Purity: 95.0%

Molecular weight: 175.7

Ref: 10-F385879

(Spiro[2.5]oct-1-ylmethyl)amine hydrochloride

CAS: 1559059-75-4

Versatile small molecule scaffold

Formula: C₉H₁₈ClN

Purity: Min. 95%

Molecular weight: 175.7 g/mol

Ref: 3D-JMC05975