CAS 1559059-79-8

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)

Description:

Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine moieties. This compound typically exists as a hydrochloride salt, enhancing its solubility in aqueous environments, which is beneficial for various applications, particularly in pharmaceutical contexts. The tetrahydro configuration indicates the presence of a saturated ring system, contributing to its stability and potentially influencing its biological activity. The compound may exhibit properties such as anti-inflammatory, analgesic, or antitumor activities, making it of interest in medicinal chemistry. Its molecular interactions are influenced by the presence of amino and hydrochloride functional groups, which can participate in hydrogen bonding and ionic interactions. As with many heterocyclic compounds, the specific arrangement of atoms and functional groups plays a crucial role in determining its reactivity and potential applications in drug development. Further studies are often required to fully elucidate its pharmacological properties and mechanisms of action.

Formula: C₆H₁₀N₄·2ClH

InChI: InChI=1S/C6H10N4.2ClH/c7-5-4-9-10-3-1-2-8-6(5)10;;/h4,8H,1-3,7H2;2*1H

InChI key: InChIKey=ZXQJNCGXXPUOPN-UHFFFAOYSA-N

SMILES: NC1=C2N(CCCN2)N=C1.Cl

Synonyms:

• Pyrazolo[1,5-a]pyrimidin-3-amine, 4,5,6,7-tetrahydro-, hydrochloride (1:2)

4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-amine dihydrochloride

CAS: 1559059-79-8

Formula: C₆H₁₂Cl₂N₄

Purity: 95.0%

Molecular weight: 211.09

Ref: 10-F385922