CAS 1559059-81-2

6-(Chloromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:

6-(Chloromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chloromethyl group at the 6-position enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high solubility in polar organic solvents, and its chemical properties are influenced by the electron-withdrawing nature of the chlorine atom, which can affect nucleophilic substitution reactions. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug discovery. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 6-(Chloromethyl)-1H-pyrrolo[2,3-b]pyridine is a significant compound in synthetic organic chemistry with potential applications in various fields.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c9-5-7-2-1-6-3-4-10-8(6)11-7/h1-4H,5H2,(H,10,11)

InChI key: InChIKey=VDJZAHDFLSNLGB-UHFFFAOYSA-N

SMILES: C(Cl)C=1N=C2C(=CC1)C=CN2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 6-(chloromethyl)-
• 6-(Chloromethyl)-1H-pyrrolo[2,3-b]pyridine

6-(chloromethyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 1559059-81-2

Formula: C₈H₇ClN₂

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 166.61

Ref: 10-F360395