CAS 1559059-85-6

4H-1,2,4-Triazole-3-methanamine, α,4-dimethyl-, hydrochloride (1:1)

Description:

4H-1,2,4-Triazole-3-methanamine, α,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound features an amine functional group, contributing to its potential biological activity, particularly in pharmaceutical applications. It may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. The presence of the dimethyl groups on the triazole ring can influence its lipophilicity and overall reactivity. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₅H₁₀N₄·ClH

InChI: InChI=1S/C5H10N4.ClH/c1-4(6)5-8-7-3-9(5)2;/h3-4H,6H2,1-2H3;1H

InChI key: InChIKey=BDBWHFVLSYIABK-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N(C)C=NN1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, α,4-dimethyl-, hydrochloride (1:1)

[1-(4-methyl-4H-1,2,4-triazol-3-yl)ethyl]amine hydrochloride

CAS: 1559059-85-6

Formula: C₅H₁₁ClN₄

Purity: 95.0%

Molecular weight: 162.62

Ref: 10-F385935