CAS 1559059-86-7

Imidazo[2,1-b]thiazole-3-methanamine, 5,6-dihydro-, hydrobromide (1:2)

Description:

Imidazo[2,1-b]thiazole-3-methanamine, 5,6-dihydro-, hydrobromide (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity, making it of interest in medicinal chemistry. The hydrobromide salt form indicates that it is a protonated version of the base compound, which can enhance its solubility and stability in various solvents. The presence of the methanamine group suggests that it may participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structure may confer specific pharmacological properties, potentially influencing its interaction with biological targets. As with many heterocycles, it may exhibit fluorescence or other optical properties, depending on its substituents. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of drug development and materials science.

Formula: C₆H₉N₃S·2BrH

InChI: InChI=1S/C6H9N3S.2BrH/c7-3-5-4-10-6-8-1-2-9(5)6;;/h4H,1-3,7H2;2*1H

InChI key: InChIKey=CWUGRPXDDPYKFA-UHFFFAOYSA-N

SMILES: C(N)C=1N2C(SC1)=NCC2.Br

Synonyms:

• Imidazo[2,1-b]thiazole-3-methanamine, 5,6-dihydro-, hydrobromide (1:2)

(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl)amine dihydrobromide

CAS: 1559059-86-7

Purity: 95.0%

Molecular weight: 317.0400085449219

Ref: 10-F385907