CAS 1559059-89-0

2H-Pyrido[1,2-a]pyrazine-6-carboxylic acid, 1,3,4,8-tetrahydro-1,8-dioxo-, hydrate (1:1)

Description:

2H-Pyrido[1,2-a]pyrazine-6-carboxylic acid, 1,3,4,8-tetrahydro-1,8-dioxo-, hydrate (1:1) is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrazine rings. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. As a hydrate, it contains water molecules in its crystalline structure, which can influence its solubility and stability. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1559059-89-0, allows for precise identification in chemical databases. Overall, this substance is notable for its potential applications in medicinal chemistry and its unique structural features that may confer specific reactivity and interactions in biological systems.

Formula: C₉H₈N₂O₄·H₂O

InChI: InChI=1S/C9H8N2O4.H2O/c12-5-3-6-8(13)10-1-2-11(6)7(4-5)9(14)15;/h3-4H,1-2H2,(H,10,13)(H,14,15);1H2

InChI key: InChIKey=LMXLTECJZQSYAH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=CC(=O)C1)C(=O)NCC2.O

Synonyms:

• 2H-Pyrido[1,2-a]pyrazine-6-carboxylic acid, 1,3,4,8-tetrahydro-1,8-dioxo-, hydrate (1:1)

1,8-dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid hydrate

CAS: 1559059-89-0

Formula: C₉H₁₀N₂O₅

Purity: 95.0%

Molecular weight: 226.188

Ref: 10-F401964