CAS 1559059-96-9

1H-1,2,4-Triazole-3-methanol, 5-bromo-, hydrobromide (1:1)

Description:

1H-1,2,4-Triazole-3-methanol, 5-bromo-, hydrobromide (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a bromine atom at the 5-position of the triazole ring and a hydroxymethyl group (-CH2OH) at the 3-position, contributing to its reactivity and potential biological activity. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents and influencing its stability and handling properties. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for interactions with biological targets, and it may serve as a precursor or intermediate in the synthesis of other bioactive molecules. As with many triazole derivatives, it may also possess antifungal or antimicrobial properties, although specific biological activities would require further investigation.

Formula: C₃H₄BrN₃O·BrH

InChI: InChI=1S/C3H4BrN3O.BrH/c4-3-5-2(1-8)6-7-3;/h8H,1H2,(H,5,6,7);1H

InChI key: InChIKey=ZUQCODZAHRTMRQ-UHFFFAOYSA-N

SMILES: C(O)C=1NC(Br)=NN1.Br

Synonyms:

• 1H-1,2,4-Triazole-3-methanol, 5-bromo-, hydrobromide (1:1)

(3-bromo-1H-1,2,4-triazol-5-yl)methanol hydrobromide

CAS: 1559059-96-9

Formula: C₃H₅Br₂N₃O

Purity: 95.0%

Molecular weight: 258.901

Ref: 10-F385965