CAS 1559062-04-2

1H-1,2,4-Triazole-1-ethanol, 3-amino-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-1-ethanol, 3-amino-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered aromatic ring containing three nitrogen atoms. This compound features an ethanol moiety and an amino group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its triazole framework is known for its role in antifungal and antimicrobial agents, indicating possible therapeutic applications. The compound's stability, solubility, and reactivity can be influenced by the pH of the environment, and it may exhibit specific pharmacokinetic properties relevant to drug development. Overall, this compound represents a class of heterocyclic compounds that are significant in both synthetic and medicinal chemistry.

Formula: C₄H₈N₄O·ClH

InChI: InChI=1S/C4H8N4O.ClH/c5-4-6-3-8(7-4)1-2-9;/h3,9H,1-2H2,(H2,5,7);1H

InChI key: InChIKey=VCFDDAFQXQELOV-UHFFFAOYSA-N

SMILES: C(CO)N1N=C(N)N=C1.Cl

Synonyms:

• 1H-1,2,4-Triazole-1-ethanol, 3-amino-, hydrochloride (1:1)

2-(3-amino-1H-1,2,4-triazol-1-yl)ethanol hydrochloride

CAS: 1559062-04-2

Formula: C₄H₉ClN₄O

Purity: 95.0%

Molecular weight: 164.59

Ref: 10-F385917