CAS 1559062-05-3

Benzenamine, 3-(3-ethyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

Description:

Benzenamine, 3-(3-ethyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a benzene ring substituted with an amino group and a triazole moiety. The presence of the triazole ring contributes to its potential biological activity, as triazoles are known for their role in pharmaceuticals, particularly as antifungal agents. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in water, which is often beneficial for biological applications. This compound may exhibit properties such as moderate to high stability under standard conditions, and its interactions can be influenced by the presence of the hydrochloride group. Additionally, the ethyl substitution on the triazole ring may affect its lipophilicity and overall pharmacokinetic profile. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential for biological activity and the presence of nitrogen-containing heterocycles.

Formula: C₁₀H₁₂N₄·2ClH

InChI: InChI=1S/C10H12N4.2ClH/c1-2-9-12-10(14-13-9)7-4-3-5-8(11)6-7;;/h3-6H,2,11H2,1H3,(H,12,13,14);2*1H

InChI key: InChIKey=FFNSYNIYBJPUEO-UHFFFAOYSA-N

SMILES: C(C)C=1NC(=NN1)C2=CC(N)=CC=C2.Cl

Synonyms:

• Benzenamine, 3-(3-ethyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

[3-(5-ethyl-4H-1,2,4-triazol-3-yl)phenyl]amine dihydrochloride

CAS: 1559062-05-3

Formula: C₁₀H₁₄Cl₂N₄

Purity: 95.0%

Molecular weight: 261.15

Ref: 10-F385923