CAS 1559062-08-6

Thieno[2,3-d]pyrimidin-4(1H)-one, 2-methyl-, hydrochloride (1:1)

Description:

Thieno[2,3-d]pyrimidin-4(1H)-one, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure that incorporates both thieno and pyrimidine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The hydrochloride salt form indicates that it is a protonated version of the base compound, which often enhances its solubility in water and may influence its pharmacokinetic properties. The presence of the methyl group at the 2-position of the pyrimidinone ring can affect its reactivity and biological interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can be optimized for specific therapeutic applications. As with many heterocycles, it may exhibit a range of activities, including antimicrobial, antiviral, or anticancer properties, making it a subject of research in drug discovery and development.

Formula: C₇H₆N₂OS·ClH

InChI: InChI=1S/C7H6N2OS.ClH/c1-4-8-6(10)5-2-3-11-7(5)9-4;/h2-3H,1H3,(H,8,9,10);1H

InChI key: InChIKey=PHBSVQPNKOKQNH-UHFFFAOYSA-N

SMILES: O=C1C2=C(NC(C)=N1)SC=C2.Cl

Synonyms:

• Thieno[2,3-d]pyrimidin-4(1H)-one, 2-methyl-, hydrochloride (1:1)

2-methylthieno[2,3-d]pyrimidin-4(3H)-one hydrochloride

CAS: 1559062-08-6

Formula: C₇H₇ClN₂OS

Purity: 95.0%

Molecular weight: 202.66

Ref: 10-F385945