CAS 1559062-13-3

Benzenamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Description:

Benzenamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1) is an organic compound characterized by its amine and ether functional groups. The presence of the benzenamine structure indicates that it has an aromatic ring, which contributes to its stability and potential reactivity. The 2-propyn-1-yloxy group introduces a propyne moiety, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and chemical synthesis. The hydrochloride form also suggests that the compound may exhibit basic properties due to the amine group, allowing it to act as a proton acceptor. Its molecular structure may influence its biological activity, making it of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.

Formula: C₉H₉NO·ClH

InChI: InChI=1S/C9H9NO.ClH/c1-2-7-11-9-6-4-3-5-8(9)10;/h1,3-6H,7,10H2;1H

InChI key: InChIKey=TVSAEWXHJPZLKN-UHFFFAOYSA-N

SMILES: O(CC#C)C1=C(N)C=CC=C1.Cl

Synonyms:

• Benzenamine, 2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

2-(Prop-2-yn-1-yloxy)aniline hydrochloride

CAS: 1559062-13-3

2-(Prop-2-yn-1-yloxy)aniline hydrochloride

Purity: 95%

Molecular weight: 183.64g/mol

Ref: 54-OR1052016

[2-(2-propyn-1-yloxy)phenyl]amine hydrochloride

CAS: 1559062-13-3

Formula: C₉H₁₀ClNO

Purity: 95.0%

Molecular weight: 183.64

Ref: 10-F386011