CAS 1559062-18-8

Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-fluoro-6-methyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-fluoro-6-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a carboxylic acid functional group and a fluorine atom at specific positions on the aromatic ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents due to the presence of the carboxylic acid group. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility in aqueous solutions. The presence of the fluorine atom can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Such compounds are of interest in medicinal chemistry for their potential therapeutic applications, including antimicrobial and anti-inflammatory activities. Overall, the unique structural features of this compound contribute to its chemical behavior and potential utility in various scientific fields.

Formula: C₉H₈ClFN₂O₂

InChI: InChI=1S/C9H7FN2O2.ClH/c1-5-2-3-6-11-7(9(13)14)8(10)12(6)4-5;/h2-4H,1H3,(H,13,14);1H

InChI key: InChIKey=SBYIDYNVYHBJGR-UHFFFAOYSA-N

SMILES: FC=1N2C(=NC1C(O)=O)C=CC(C)=C2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-fluoro-6-methyl-, hydrochloride (1:1)
• 3-fluoro-6-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrochloride

3-fluoro-6-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrochloride

CAS: 1559062-18-8

Formula: C₉H₈ClFN₂O₂

Purity: 95.0%

Molecular weight: 230.62

Ref: 10-F385969