CAS 1559062-19-9

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, hydrate (1:1)

Description:

Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, hydrate (1:1), is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures, which contribute to its unique chemical properties. This compound typically exhibits a carboxylic acid functional group, which imparts acidic characteristics and allows for potential hydrogen bonding interactions. The presence of the hydrate indicates that it contains water molecules in its crystalline structure, influencing its solubility and stability. Pyrazolo[1,5-a]pyrimidines are known for their biological activity, often serving as scaffolds in medicinal chemistry for the development of pharmaceuticals, particularly in the fields of anti-inflammatory and anti-cancer agents. The compound's molecular interactions, including potential coordination with metal ions or participation in various chemical reactions, make it of interest in both synthetic and medicinal chemistry. Its specific properties, such as melting point, solubility, and reactivity, can vary based on the hydration state and the presence of substituents on the ring structures.

Formula: C₇H₅N₃O₂·H₂O

InChI: InChI=1S/C7H5N3O2.H2O/c11-7(12)5-4-6-8-2-1-3-10(6)9-5;/h1-4H,(H,11,12);1H2

InChI key: InChIKey=FDARJMZYLCCSJK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2N(N1)C=CC=N2.O

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, hydrate (1:1)

pyrazolo[1,5-a]pyrimidine-2-carboxylic acid hydrate

CAS: 1559062-19-9

Formula: C₇H₇N₃O₃

Purity: 95.0%

Molecular weight: 181.151

Ref: 10-F541594