CAS 1559064-02-6

Ethanamine, 2-[(4-methyl-4H-1,2,4-triazol-3-yl)thio]-, hydrochloride (1:1)

Description:

Ethanamine, 2-[(4-methyl-4H-1,2,4-triazol-3-yl)thio]-, hydrochloride (1:1), with CAS number 1559064-02-6, is a chemical compound characterized by its amine functional group and a triazole moiety, which contributes to its biological activity. The presence of the thioether linkage indicates that it contains sulfur, which can enhance its reactivity and potential interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or antifungal activity due to the triazole structure, which is known for its role in various therapeutic agents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity. Further studies would be necessary to fully elucidate its pharmacological properties and potential uses.

Formula: C₅H₁₀N₄S·ClH

InChI: InChI=1S/C5H10N4S.ClH/c1-9-4-7-8-5(9)10-3-2-6;/h4H,2-3,6H2,1H3;1H

InChI key: InChIKey=KZEDGPXGUCTPAT-UHFFFAOYSA-N

SMILES: S(CCN)C=1N(C)C=NN1.Cl

Synonyms:

• Ethanamine, 2-[(4-methyl-4H-1,2,4-triazol-3-yl)thio]-, hydrochloride (1:1)

{2-[(4-methyl-4H-1,2,4-triazol-3-yl)thio]ethyl}amine hydrochloride

CAS: 1559064-02-6

Formula: C₅H₁₁ClN₄S

Purity: 95.0%

Molecular weight: 194.68

Ref: 10-F385878