CAS 1559064-09-3

1H-Imidazole-5-carboxylic acid, 4-methyl-2-phenyl-, hydrate (1:1)

Description:

1H-Imidazole-5-carboxylic acid, 4-methyl-2-phenyl-, hydrate (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a phenyl group that enhances its aromatic character. The presence of a methyl group at the 4-position of the imidazole ring adds to its molecular complexity and can influence its solubility and reactivity. As a hydrate, it contains water molecules in its crystalline structure, which can affect its stability and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its unique structural features allow for potential applications in drug development, particularly in the design of compounds that interact with biological targets. Overall, the characteristics of this substance make it a valuable compound for further study in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₀N₂O₂·H₂O

InChI: InChI=1S/C11H10N2O2.H2O/c1-7-9(11(14)15)13-10(12-7)8-5-3-2-4-6-8;/h2-6H,1H3,(H,12,13)(H,14,15);1H2

InChI key: InChIKey=KJNXKRTWGLREGH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1NC(=NC1C)C2=CC=CC=C2.O

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 4-methyl-2-phenyl-, hydrate (1:1)

5-methyl-2-phenyl-1H-imidazole-4-carboxylic acid hydrate

CAS: 1559064-09-3

Formula: C₁₁H₁₂N₂O₃

Purity: 95.0%

Molecular weight: 220.228

Ref: 10-F401854