CAS 15591-41-0

3-Thiazolidineethanol, 2-imino-α-phenyl-, hydrochloride (1:1)

Description:

3-Thiazolidineethanol, 2-imino-α-phenyl-, hydrochloride (1:1), with the CAS number 15591-41-0, is a chemical compound characterized by its thiazolidine ring structure, which incorporates both sulfur and nitrogen atoms. This compound features an imino group and a phenyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The presence of the thiazolidine moiety suggests potential relevance in medicinal chemistry, particularly in the development of drugs targeting metabolic disorders or other therapeutic areas. Its molecular structure may exhibit chirality, leading to different stereoisomers with varying biological effects. The compound's properties, such as melting point, solubility, and reactivity, would be influenced by its functional groups and the hydrochloride form. Overall, 3-Thiazolidineethanol, 2-imino-α-phenyl-, hydrochloride is of interest for its potential applications in drug development and research.

Formula: C₁₁H₁₄N₂OS·ClH

InChI: InChI=1S/C11H14N2OS.ClH/c12-11-13(6-7-15-11)8-10(14)9-4-2-1-3-5-9;/h1-5,10,12,14H,6-8H2;1H

InChI key: InChIKey=HXCSOQNQZVYAJC-UHFFFAOYSA-N

SMILES: C(C(O)C1=CC=CC=C1)N2C(=N)SCC2.Cl

Synonyms:

• 2-Imino-α-phenyl-3-thiazolidineethanol hydrochloride
• 3-Thiazolidineethanol, 2-imino-α-phenyl-, monohydrochloride
• 2-(2-Imino-1,3-thiazolidin-3-yl)-1-phenylethan-1-ol hydrochloride
• 3-Thiazolidineethanol, 2-imino-α-phenyl-, hydrochloride (1:1)