CAS 155944-24-4: (-)-Cangorinine E-I

Description:(-)-Cangorinine E-I, with the CAS number 155944-24-4, is a naturally occurring alkaloid that belongs to the class of compounds known as isoquinoline alkaloids. These compounds are characterized by their complex bicyclic structures, which typically include a benzene ring fused to a nitrogen-containing heterocycle. (-)-Cangorinine E-I is derived from plant sources and is often studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. The stereochemistry of this compound is significant, as the designation "(-)" indicates that it is the levorotatory form, which can exhibit different biological activities compared to its enantiomer. Its molecular structure includes various functional groups that contribute to its reactivity and interaction with biological systems. Research into (-)-Cangorinine E-I may provide insights into its mechanisms of action and potential therapeutic applications, although detailed studies on its efficacy and safety are essential for understanding its role in medicinal chemistry.

Formula:C₄₃H₄₉NO₁₈

InChI:InChI=1S/C43H49NO18/c1-20-21(2)37(50)61-34-32(57-24(5)47)36(59-26(7)49)42(19-54-22(3)45)35(58-25(6)48)31(56-23(4)46)29-33(60-38(51)27-14-11-10-12-15-27)43(42,41(34,9)53)62-40(29,8)18-55-39(52)28-16-13-17-44-30(20)28/h10-17,20-21,29,31-36,53H,18-19H2,1-9H3/t20-,21-,29+,31+,32-,33+,34-,35+,36-,40-,41-,42+,43-/m0/s1

InChI key:InChIKey=DPTIBNOQWFLHCG-UAYAMSOCSA-N

SMILES:O=C1OCC2(OC34C(OC(=O)C=5C=CC=CC5)C2C(OC(=O)C)C(OC(=O)C)C4(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C(OC(=O)C(C)C(C6=NC=CC=C16)C)C3(O)C)C

Synonyms:
(-)-Cangorinine E-I
Evonine, 8-(acetyloxy)-O6-benzoyl-O6-deacetyl-8-deoxo-, (8α)-
8,11-Epoxy-9,12-ethano-11,15-methano-11H-[1,8]dioxacycloheptadecino[4,3-b]pyridine-5,17-dione, 13,14,21,22-tetrakis(acetyloxy)-12-[(acetyloxy)methyl]-10-(benzoyloxy)-7,8,9,10,12,13,14,15,18,19-decahydro-20-hydroxy-8,18,19,20-tetramethyl-, (8R,9R,10R,11S,12R,13R,14R,15S,18S,19S,20S,21S,22R)-
Cangorinine E-I
(8R,9R,10R,11S,12R,13R,14R,15S,18S,19S,20S,21S,22R)-13,14,21,22-Tetrakis(acetyloxy)-12-[(acetyloxy)methyl]-10-(benzoyloxy)-7,8,9,10,12,13,14,15,18,19-decahydro-20-hydroxy-8,18,19,20-tetramethyl-8,11-epoxy-9,12-ethano-11,15-methano-11H-[1,8]dioxacycloheptadecino[4,3-b]pyridine-5,17-dione