CAS 155960-93-3

Quinazoline, 4-chloro-6-(methylthio)-

Description:

Quinazoline, 4-chloro-6-(methylthio)- is a heterocyclic compound characterized by a fused bicyclic structure containing a benzene ring and a pyrimidine ring. The presence of a chlorine atom at the 4-position and a methylthio group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Quinazoline derivatives are of significant interest in medicinal chemistry due to their potential biological activities, including antimicrobial, anti-inflammatory, and anticancer properties. The methylthio group can influence the compound's reactivity and interaction with biological targets. Additionally, the chlorine substituent may enhance the lipophilicity and overall pharmacokinetic profile of the molecule. As with many quinazoline derivatives, this compound may serve as a scaffold for the development of new pharmaceuticals, making it a subject of research in drug discovery and development.

Formula: C₉H₇ClN₂S

InChI: InChI=1S/C9H7ClN2S/c1-13-6-2-3-8-7(4-6)9(10)12-5-11-8/h2-5H,1H3

InChI key: InChIKey=NWMNIOBPSAXMMY-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=CC(SC)=C2)N=CN1

Synonyms:

• 4-Chloro-6-(methylthio)quinazoline
• Quinazoline, 4-chloro-6-(methylthio)-

4-Chloro-6-(methylsulfanyl)quinazoline

CAS: 155960-93-3

Versatile small molecule scaffold

Formula: C₉H₇ClN₂S

Purity: Min. 95%

Molecular weight: 210.68 g/mol

Ref: 3D-FGA96093