CAS 155983-98-5

2H-1,2,4-Benzothiadiazin-3(4H)-one, 5-bromo-, 1,1-dioxide

Description:

2H-1,2,4-Benzothiadiazin-3(4H)-one, 5-bromo-, 1,1-dioxide, commonly referred to as a benzothiadiazinone derivative, is a chemical compound characterized by its unique bicyclic structure that incorporates both sulfur and nitrogen atoms. This compound typically exhibits properties such as high stability under standard conditions and solubility in polar organic solvents. The presence of the bromine substituent at the 5-position enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The 1,1-dioxide functional group contributes to its overall chemical behavior, often affecting its electron distribution and potential interactions with biological targets. Additionally, compounds of this class are known for their potential applications in various fields, including agrochemicals and medicinal chemistry, due to their ability to modulate biological pathways. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₅BrN₂O₃S

InChI: InChI=1S/C7H5BrN2O3S/c8-4-2-1-3-5-6(4)9-7(11)10-14(5,12)13/h1-3H,(H2,9,10,11)

InChI key: InChIKey=UNWFVIMGKIDJKB-UHFFFAOYSA-N

SMILES: BrC1=C2C(S(=O)(=O)NC(=O)N2)=CC=C1

Synonyms:

• 2H-1,2,4-Benzothiadiazin-3(4H)-one, 5-bromo-, 1,1-dioxide

5-BROMO-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE

CAS: 155983-98-5

Formula: C₇H₅BrN₂O₃S

Purity: 95.0%

Molecular weight: 277.09

Ref: 10-F505850

5-Bromo-2H-Benzo[E][1,2,4]Thiadiazin-3(4H)-One 1,1-Dioxide

CAS: 155983-98-5

Formula: C₇H₅BrN₂O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 277.0952

Ref: IN-DA00HYCY