CAS 156-06-9: Phenylpyruvic acid
Description:Phenylpyruvic acid, with the CAS number 156-06-9, is an organic compound characterized by its structure, which includes a phenyl group attached to a pyruvic acid moiety. It appears as a white to pale yellow crystalline solid and is soluble in water and organic solvents. This compound is notable for its role in metabolic pathways, particularly in the context of phenylketonuria (PKU), a genetic disorder where the body cannot properly metabolize phenylalanine, leading to an accumulation of phenylpyruvic acid. Its chemical formula is C9H10O3, and it has a carboxylic acid functional group, contributing to its acidic properties. Phenylpyruvic acid can participate in various chemical reactions, including esterification and decarboxylation. Additionally, it has been studied for its potential biological activities, including its effects on neurotransmitter levels and its role in cellular metabolism. Overall, phenylpyruvic acid is significant in both biochemical research and clinical contexts, particularly concerning metabolic disorders.
Formula:C9H8O3
InChI:InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)
InChI key:InChIKey=BTNMPGBKDVTSJY-UHFFFAOYSA-N
SMILES:O=C(O)C(=O)CC=1C=CC=CC1
- Synonyms:
- 2-Oxo-3-phenylpropanoic acid
- 2-Oxo-3-phenylpropionic acid
- 3-Phenyl-2-oxopropanoic acid
- 3-Phenylbrenztraubensaure
- 3-Phenylpyruvic Acid
- Acide 3-phenylpyruvique
- Acido 3-Fenilpiruvico
- Phenylpyroracemic acid
- Phenylpyruvic Acid
- Pyruvic acid, phenyl-
- See more synonyms
- α-Oxobenzenepropanoic acid
- β-Phenylpyruvic acid
- Benzenepropanoic acid, α-oxo-
