CAS 156001-53-5: 5-Bromo-2-(bromomethyl)benzonitrile

Description:5-Bromo-2-(bromomethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a nitrile functional group. The presence of the bromomethyl group indicates that there is a bromine atom attached to a methylene (-CH2-) group, which is further connected to a benzene ring that also contains a nitrile (-C≡N) group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic nature. The bromine substituents can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the nitrile group can participate in further transformations, such as hydrolysis or reduction. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 5-Bromo-2-(bromomethyl)benzonitrile serves as an important intermediate in organic synthesis and materials science.

Formula:C₈H₅Br₂N

InChI:InChI=1S/C8H5Br2N/c9-4-6-1-2-8(10)3-7(6)5-11/h1-3H,4H2

InChI key:InChIKey=RPQAJIVYLBTILC-UHFFFAOYSA-N

SMILES:N#CC1=CC(Br)=CC=C1CBr

Synonyms:
2-Cyano-4-bromobenzyl bromide
5-Bromo-2-(Bromomethyl)Benzonitrile
5-Bromo-2-bromomethylbenzonitrile
Benzonitrile, 5-bromo-2-(bromomethyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzonitrile, 5-bromo-2-(bromomethyl)- REF: IN-DA001OGKCAS: 156001-53-5	95%	To inquire	Mon 07 Apr 25
5-Bromo-2-(bromomethyl)benzonitrile REF: 54-OR941937CAS: 156001-53-5	95+%	151.00 €~1,807.00 €	Tue 08 Apr 25
5-Bromo-2-(bromomethyl)benzonitrile REF: 10-F468456CAS: 156001-53-5	95.0%	To inquire	Tue 15 Apr 25
5-bromo-2-(bromomethyl)benzonitrile REF: 3D-FB159769CAS: 156001-53-5	Min. 95%	- - -	Discontinued product