CymitQuimica logo

CAS 156001-68-2

:

methyl 3-cyano-4-hydroxy-benzoate

Description:
Methyl 3-cyano-4-hydroxybenzoate, with the CAS number 156001-68-2, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of a cyano group (-CN) and a hydroxyl group (-OH) on the aromatic ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals due to the presence of functional groups that can participate in various chemical reactions. The hydroxyl group may contribute to its reactivity, allowing for hydrogen bonding, while the cyano group can enhance its electronic properties. Additionally, methyl 3-cyano-4-hydroxybenzoate may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a versatile building block in organic synthesis and material science.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c1-13-9(12)6-2-3-8(11)7(4-6)5-10/h2-4,11H,1H3
InChI key:AHPCEMBOTQXADD-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(c(c1)C#N)O
Synonyms:
  • Benzoic Acid, 3-Cyano-4-Hydroxy-, Methyl Ester
  • Methyl-3-cyan-4-hydroxybenzoat
  • Methyl 3-Cyano-4-Hydroxybenzoate
Found 4 products.