CAS 15601-44-2
:4-(4-chlorobenzylidene)-2-phenyl-1,3-oxazol-5(4H)-one
Description:
4-(4-Chlorobenzylidene)-2-phenyl-1,3-oxazol-5(4H)-one, with the CAS number 15601-44-2, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a phenyl group and a chlorobenzylidene moiety, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit various physical properties such as solubility in organic solvents. The presence of the chlorobenzylidene group can influence its electronic properties, making it of interest in organic synthesis and medicinal chemistry. Additionally, compounds of this type may demonstrate fluorescence or other optical properties, which can be useful in various applications, including dye chemistry and as potential pharmaceuticals. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and usage guidelines.
Formula:C16H10ClNO2
InChI:InChI=1/C16H10ClNO2/c17-13-8-6-11(7-9-13)10-14-16(19)20-15(18-14)12-4-2-1-3-5-12/h1-10H
SMILES:c1ccc(cc1)C1=NC(=Cc2ccc(cc2)Cl)C(=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.