CAS 156012-92-9
:(3β)-20-(β-D-Glucopyranosyloxy)dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
Description:
The chemical substance known as "(3β)-20-(β-D-Glucopyranosyloxy)dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside," with the CAS number 156012-92-9, is a glycosylated dammarane-type triterpene. This compound features a complex structure characterized by multiple sugar moieties, specifically β-D-glucopyranosyl groups, which contribute to its solubility and biological activity. The dammarane skeleton is known for its presence in various plants and is associated with a range of pharmacological properties, including anti-inflammatory and anticancer effects. The glycosylation enhances the compound's stability and bioavailability, making it of interest in medicinal chemistry and natural product research. Its structural complexity suggests potential interactions with biological systems, which may lead to various therapeutic applications. Additionally, the presence of multiple hydroxyl groups in the glucopyranosyl units may facilitate hydrogen bonding, influencing the compound's solubility and reactivity in different environments. Overall, this substance represents a fascinating area of study within the field of natural products and their potential health benefits.
Formula:C48H82O17
InChI:InChI=1S/C48H82O17/c1-23(2)10-9-16-48(8,65-42-39(59)36(56)33(53)27(21-50)61-42)25-13-18-46(6)24(25)11-12-30-45(5)17-15-31(44(3,4)29(45)14-19-47(30,46)7)63-43-40(37(57)34(54)28(22-51)62-43)64-41-38(58)35(55)32(52)26(20-49)60-41/h10,24-43,49-59H,9,11-22H2,1-8H3/t24-,25+,26-,27-,28-,29+,30-,31+,32-,33-,34-,35+,36+,37+,38-,39-,40-,41+,42+,43+,45+,46-,47-,48+/m1/s1
InChI key:InChIKey=NJPDRQDELKMUTI-NIUQCDFYSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4)CC3)[H])(CC[C@]6([C@@]2(C)CC[C@@]6([C@@](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)(CCC=C(C)C)C)[H])[H])[H]
Synonyms:- (3β)-20-(β-D-Glucopyranosyloxy)dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Vinaginsenoside R3
- β-D-Glucopyranoside, (3β)-20-(β-D-glucopyranosyloxy)dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
β-D-Glucopyranoside, (3β)-20-(β-D-glucopyranosyloxy)dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
CAS:Formula:C48H82O17Purity:98%Molecular weight:931.1545Vinaginsenoside R3
CAS:Vinaginsenoside R3 is a natural product of Panax, Araliaceae.Formula:C48H82O17Purity:98%Color and Shape:SolidMolecular weight:931.167vina-ginsenoside R3
CAS:Vina-Ginsenoside R3 is a bioactive compound, which is a naturally occurring saponin derived from the Panax ginseng plant. It is specifically extracted and isolated from the root of this traditional medicinal herb. The mode of action of Vina-Ginsenoside R3 involves its interaction with cellular pathways that modulate oxidative stress, inflammation, and cellular metabolism. It has been shown to influence the signaling pathways that are critical in maintaining cellular homeostasis and resilience under stress conditions.
Formula:C48H82O17Purity:Min. 95%Molecular weight:931.17 g/molRef: 3D-GGA01292
Discontinued product




