CymitQuimica logo

CAS 1561-52-0

:

2-Iodo-1-trifluoromethoxy-tetrafluoroethane

Description:
2-Iodo-1-trifluoromethoxy-tetrafluoroethane, with the CAS number 1561-52-0, is a halogenated organic compound characterized by the presence of iodine and multiple fluorine atoms, which significantly influence its chemical properties. This compound features a tetrafluoroethane backbone, making it highly fluorinated and thus exhibiting low reactivity and high stability under various conditions. The trifluoromethoxy group contributes to its unique electronic properties, enhancing its polarity and potential solubility in polar solvents. The presence of iodine introduces a heavier halogen, which can affect the compound's reactivity, particularly in nucleophilic substitution reactions. Due to its fluorinated nature, this substance is likely to have low volatility and high thermal stability, making it suitable for applications in specialized chemical processes or as a solvent in certain reactions. Additionally, the environmental impact of such halogenated compounds is a consideration, as they may contribute to atmospheric persistence and potential toxicity. Overall, 2-Iodo-1-trifluoromethoxy-tetrafluoroethane is a complex molecule with distinct characteristics stemming from its halogenated structure.
Formula:C3F7IO
InChI:InChI=1/C3F7IO/c4-1(5,11)2(6,7)12-3(8,9)10
InChI key:AWVOEAIUILBLRE-UHFFFAOYSA-N
SMILES:C(C(F)(F)OC(F)(F)F)(F)(F)I
Synonyms:
  • 1,1,2,2-Tetrafluoro-1-Iodo-2-(Trifluoromethoxy)Ethane
  • 2-Iodo-1-(trifluoromethoxy)tetrafluoroethane
Found 2 products.