CAS 156101-08-5
:Erinacine A
Description:
Erinacine A is a bioactive compound primarily derived from the fruiting bodies and mycelium of the medicinal mushroom Hericium erinaceus, commonly known as lion's mane mushroom. It belongs to a class of compounds known as erinacines, which are known for their neuroprotective and neuroregenerative properties. Erinacine A has garnered attention for its potential to stimulate the synthesis of nerve growth factor (NGF), which is crucial for the growth, maintenance, and survival of neurons. This compound exhibits a complex chemical structure characterized by a bicyclic core and various functional groups that contribute to its biological activity. In addition to its neuroprotective effects, Erinacine A has been studied for its potential anti-inflammatory and antioxidant properties, making it a subject of interest in research related to neurodegenerative diseases and cognitive health. Its safety profile and efficacy are still under investigation, but preliminary studies suggest it may offer therapeutic benefits in promoting brain health and function.
Formula:C25H36O6
InChI:InChI=1S/C25H36O6/c1-14(2)16-7-8-24(3)9-10-25(4)17(20(16)24)6-5-15(12-26)11-19(25)31-23-22(29)21(28)18(27)13-30-23/h5-6,12,14,18-19,21-23,27-29H,7-11,13H2,1-4H3/t18-,19+,21+,22-,23+,24-,25-/m1/s1
InChI key:InChIKey=LPPCHLAEVDUIIW-NLLUTMDRSA-N
SMILES:C[C@]12C(C=3[C@](C)([C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](O)CO4)CC(C=O)=CC3)CC1)=C(C(C)C)CC2
Synonyms:- (+)-Erinacin A
- Cyclohept[e]indene-8-carboxaldehyde, 2,3,3a,4,5,5a,6,7-octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)-, [3aR-(3aα,5aβ,6α)]-
- Erinacin A
- (3aR,5aR,6S)-2,3,3a,4,5,5a,6,7-Octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)cyclohept[e]indene-8-carboxaldehyde
- Cyclohept[e]indene-8-carboxaldehyde, 2,3,3a,4,5,5a,6,7-octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)-, (3aR,5aR,6S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Erinacine A
CAS:Erinacine A ((+)-Erinacin A) is a cyanoalkane diterpene derived from the monkey fungus, a neuroprotective agent with anticancer activity.Formula:C25H36O6Purity:99.82%Color and Shape:SoildMolecular weight:432.55(+)-erinacin a
CAS:Natural glycosideFormula:C25H36O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:432.55(+)-Erinacin A
CAS:(+)-Erinacin A is a bioactive compound, specifically a cyathane diterpenoid, which is isolated from the mushroom Hericium erinaceus, commonly known as the Lion’s Mane mushroom. This compound is notable for its mode of action that involves the induction of nerve growth factor (NGF) synthesis, which is crucial in supporting neuronal growth, maintenance, and repair.Formula:C25H36O6Purity:Min. 95%Color and Shape:PowderMolecular weight:432.5 g/mol







