CAS 156117-44-1
:6-CHLORO-3-INDOXYL-N-ACETYL-BETA-D-GLUCOSAMINIDE
Description:
6-Chloro-3-indoxyl-N-acetyl-beta-D-glucosaminide, with the CAS number 156117-44-1, is a chemical compound that belongs to the class of indoxyl derivatives. It is characterized by the presence of a chloro group at the 6-position of the indoxyl moiety, which contributes to its reactivity and potential applications in biochemical assays. The N-acetyl-beta-D-glucosaminide portion indicates that it is a glycoside, which may influence its solubility and interaction with biological systems. This compound is often utilized in research settings, particularly in the study of glycosylation processes and enzyme activity, as it can serve as a substrate for various glycosidases. Its structural features suggest that it may exhibit specific biological activities, making it of interest in medicinal chemistry and biochemistry. Additionally, the presence of the indoxyl group may allow for colorimetric detection, which is useful in analytical applications. Overall, this compound's unique structure and functional groups make it a valuable tool in chemical and biological research.
Formula:C16H19ClN2O6
InChI:InChI=1/C16H19ClN2O6/c1-7(21)19-13-15(23)14(22)12(6-20)25-16(13)24-11-5-18-10-4-8(17)2-3-9(10)11/h2-5,12-16,18,20,22-23H,6H2,1H3,(H,19,21)/t12-,13-,14-,15-,16+/m0/s1
Synonyms:- 6-Chloro-3-Indolyl N-Acetyl-Beta-D-Glucosaminide
- 6-Chloro-3-Indoxyl-2-Acetamido-2-Deoxy-Beta-D-Galactopyranoside
- 6-Chloro-3-Indoxyl-2-Acetamido-2-Deoxy-Beta-D-Glucopyranoside
- Rarechem Ah Bs 0027
- Rosetm-N-Acetyl-Beta-D-Glucosaminide
- Rose(Tm)-N-Acetyl-Glucosaminide
- Salmon(Tm)-Beta-D-Glcnac
- N-[(2S,3S,4S,5R,6S)-2-[(6-chloro-1H-indol-3-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Chloro-3-indolyl N-acetyl-β-D-glucosaminide
CAS:6-Chloro-3-indolyl N-acetyl-β-D-glucosaminideFormula:C16H19ClN2O6Purity:>97% (hplc) (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:370.78g/mol6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:Formula:C16H19ClN2O6Molecular weight:370.806-Chloro-3-indolyl 2-acetamido-2-deoxy-β-D-glucopyranoside
CAS:6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a pink enzyme substrate commonly used in biochemical research and diagnostic applications. This compound is a derivative of indolyl glucopyranoside, which is known for its ability to produce a colored product upon enzymatic hydrolysis. 6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside is particularly useful for studying glycosidases, enzymes that cleave glycosidic bonds in complex carbohydrates. Its pink coloration makes it an ideal choice for colorimetric assays, enabling researchers to monitor enzyme activity in real-time and facilitating the development of new diagnostic tools and therapeutic strategies.
Formula:C16H19ClN2O6Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:370.78 g/mol



