CymitQuimica logo

CAS 156161-88-5

:

1-methyl-L-tryptophyl-L-norleucyl-L-alpha-aspartyl-N-{[(L-alpha-aspartyl-L-tyrosyl-D-phenylalanyl)amino]acetyl}-L-phenylalaninamide

Description:
1-Methyl-L-tryptophyl-L-norleucyl-L-alpha-aspartyl-N-{[(L-alpha-aspartyl-L-tyrosyl-D-phenylalanyl)amino]acetyl}-L-phenylalaninamide, identified by the CAS number 156161-88-5, is a complex peptide compound characterized by its intricate structure comprising multiple amino acid residues. This substance features a combination of both L- and D-amino acids, which can influence its biological activity and stability. The presence of a methyl group on the tryptophan residue may enhance its lipophilicity, potentially affecting its interaction with biological membranes. The peptide's sequence suggests it may have specific receptor binding capabilities, possibly influencing neurotransmitter systems or other physiological pathways. Additionally, the presence of various functional groups, such as amides and acetyls, indicates potential for hydrogen bonding and interactions with other biomolecules. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in biochemical research and potential therapeutic applications. However, detailed studies would be necessary to elucidate its precise biological functions and mechanisms of action.
Formula:C55H66N10O13
InChI:InChI=1/C55H66N10O13/c1-3-4-18-40(59-49(72)38(56)27-35-31-65(2)45-19-12-11-17-37(35)45)52(75)63-44(29-48(70)71)54(77)62-43(25-33-15-9-6-10-16-33)55(78)64-46(67)30-58-51(74)41(24-32-13-7-5-8-14-32)61-53(76)42(26-34-20-22-36(66)23-21-34)60-50(73)39(57)28-47(68)69/h5-17,19-23,31,38-44,66H,3-4,18,24-30,56-57H2,1-2H3,(H,58,74)(H,59,72)(H,60,73)(H,61,76)(H,62,77)(H,63,75)(H,68,69)(H,70,71)(H,64,67,78)/t38-,39-,40-,41+,42-,43-,44-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.