CAS 1562-40-9
:3-[(2-CHLOROETHYL)SULFONYL]PROPANAMIDE
Description:
3-[(2-Chloroethyl)sulfonyl]propanamide, with the CAS number 1562-40-9, is a chemical compound characterized by its sulfonamide functional group, which contributes to its reactivity and potential biological activity. This compound features a propanamide backbone, indicating the presence of an amide functional group, which is known for its stability and ability to participate in hydrogen bonding. The presence of a chloroethyl group introduces a halogen, which can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. The sulfonyl group is typically associated with increased solubility in polar solvents and can influence the compound's interaction with biological systems. This compound may exhibit various properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, due to its structural features, it may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile. Overall, its unique combination of functional groups makes it a compound of interest in synthetic and medicinal chemistry.
Formula:C5H10ClNO3S
InChI:InChI=1/C5H10ClNO3S/c6-2-4-11(9,10)3-1-5(7)8/h1-4H2,(H2,7,8)
SMILES:C(CS(=O)(=O)CCCl)C(=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(2-Chloroethanesulfonyl)propanamide
CAS:3-(2-Chloroethanesulfonyl)propanamide is a molecule that has been shown to activate cells in the muscle. Activated cells are able to divide and grow. The mechanism of activation is not known, but it may be due to the functional groups on the molecule or its benzoic acid moiety. 3-(2-Chloroethanesulfonyl)propanamide is more active in muscle than in other tissues, and it stimulates muscle growth by increasing protein synthesis. This drug is also found to have anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis.END>Formula:C5H10ClNO3SPurity:Min. 95%Molecular weight:199.66 g/mol

