CAS 156213-03-5

6-Chloro-1-methyl-1H-benzimidazole-2-propanoic acid

Description:

6-Chloro-1-methyl-1H-benzimidazole-2-propanoic acid is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a chlorine atom at the 6-position and a methyl group at the 1-position contributes to its unique reactivity and properties. The propanoic acid moiety indicates that it possesses a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and acid-base reactions. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its solubility and stability can vary depending on the pH and solvent conditions, making it important to consider these factors in practical applications. Additionally, the compound may exhibit specific biological activities, which are often investigated in the context of medicinal chemistry. As with many chemical substances, safety data and handling precautions should be reviewed before use.

Formula: C₁₁H₁₁ClN₂O₂

InChI: InChI=1S/C11H11ClN2O2/c1-14-9-6-7(12)2-3-8(9)13-10(14)4-5-11(15)16/h2-3,6H,4-5H2,1H3,(H,15,16)

InChI key: InChIKey=XPWJLVHVDASFMS-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CCC(O)=O)=CC=C(Cl)C2

Synonyms:

• 1H-Benzimidazole-2-propanoic acid, 6-chloro-1-methyl-
• 6-Chloro-1-methyl-1H-benzimidazole-2-propanoic acid

3-(6-Chloro-1-methyl-1H-benzimidazol-2-yl)propanoic acid

Controlled Product

CAS: 156213-03-5

Please enquire for more information about 3-(6-Chloro-1-methyl-1H-benzimidazol-2-yl)propanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 238.67 g/mol

Ref: 3D-FC135798