CAS 156223-07-3
:aselacin B
Description:
Aselacin B, with the CAS number 156223-07-3, is a chemical compound that belongs to the class of natural products known as alkaloids. It is primarily derived from certain species of fungi and exhibits a range of biological activities, making it of interest in pharmaceutical research. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its reactivity and interaction with biological systems. Aselacin B has been studied for its potential antimicrobial and anticancer properties, showcasing its significance in medicinal chemistry. Its solubility, stability, and bioavailability are important factors that influence its efficacy in therapeutic applications. Additionally, the compound's synthesis and extraction methods are crucial for its availability for research and potential clinical use. Overall, aselacin B represents a promising area of study within the field of natural product chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential therapeutic benefits.
Formula:C46H66N8O12
InChI:InChI=1/C46H66N8O12/c1-29(56)15-9-5-3-6-10-16-32(57)17-11-7-4-8-12-20-39(59)51-35(21-22-38(47)58)44(63)54-42-30(2)66-41(61)27-50-43(62)37(28-55)53-45(64)36(52-40(60)23-24-48-46(42)65)25-31-26-49-34-19-14-13-18-33(31)34/h3,6,10,13-14,16,18-19,26,29-30,35-37,42,49,55-56H,4-5,7-9,11-12,15,17,20-25,27-28H2,1-2H3,(H2,47,58)(H,48,65)(H,50,62)(H,51,59)(H,52,60)(H,53,64)(H,54,63)/b6-3+,16-10+
Synonyms:- Glycine, N-(N-(N-(N-(N-(N2-(17-hydroxy-1,9-dioxo-10,12-octadecadienyl)-D-glutaminyl)-L-threonyl)-beta-alanyl)-D-tryptophyl)-D-seryl)-, omicron-lactone
- Aselacin B
- N~1~-[6-(hydroxymethyl)-9-(1H-indol-3-ylmethyl)-17-methyl-2,5,8,11,15-pentaoxo-1-oxa-4,7,10,14-tetraazacycloheptadecan-16-yl]-N~2~-[(10E,12E)-17-hydroxy-9-oxooctadeca-10,12-dienoyl]glutamamide
- Glycine, N2-(17-hydroxy-1,9-dioxo-10,12-octadecadien-1-yl)-D-glutaminyl-L-threonyl-β-alanyl-D-tryptophyl-D-seryl-, (6→2)-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aselacin B
CAS:<p>Aselacin B targets the endothelin-1 receptor (ET-1 Receptor) and inhibits the binding of ET-1 to both ETA and ETB receptors. It is used in cardiovascular disease research.</p>Formula:C46H66N8O12Color and Shape:SolidMolecular weight:923.063
