CAS 156243-64-0
:4-Bromo-2,6-difluorobenzotrifluoride
Description:
4-Bromo-2,6-difluorobenzotrifluoride, with the CAS number 156243-64-0, is an aromatic compound characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, along with three fluorine substituents on a neighboring carbon. This compound is part of the class of organofluorine compounds, which are known for their unique chemical properties, including high thermal stability and resistance to degradation. The presence of multiple electronegative halogens contributes to its polarity and can influence its reactivity, making it useful in various chemical applications, including as a solvent or in the synthesis of other fluorinated compounds. Its molecular structure suggests potential applications in the fields of pharmaceuticals, agrochemicals, and materials science. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by its halogen substituents, which can affect its behavior in different environments. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks.
Formula:C7H2BrF5
InChI:InChI=1/C7H2BrF5/c8-3-1-4(9)6(5(10)2-3)7(11,12)13/h1-2H
SMILES:c1c(cc(c(c1F)C(F)(F)F)F)Br
Synonyms:- 3,5-Difluoro-4-(Trifluoromethyl)Bromobenzene
- 5-Bromo-1,3-Difluoro-2-(Trifluoromethyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2,6-difluorobenzotrifluoride, 98%
CAS:It is employed in the lewis acid-promoted synthesis of unsymmetrical and highly functionalized carbazoles and dibenzofurans from biaryl triazenes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refeFormula:C7H2BrF5Purity:98%Molecular weight:260.994-Bromo-2,6-difluorobenzotrifluoride
CAS:Formula:C7H2BrF5Purity:97%Color and Shape:ClearMolecular weight:260.989Benzene, 5-bromo-1,3-difluoro-2-(trifluoromethyl)-
CAS:Formula:C7H2BrF5Purity:97%Color and Shape:LiquidMolecular weight:260.9868Ref: IN-DA001OMJ
1g30.00€5g66.00€10g104.00€1kgTo inquire25g192.00€100g680.00€250gTo inquire500gTo inquire250mg26.00€4-Bromo-2,6-difluorobenzotrifluoride
CAS:4-Bromo-2,6-difluorobenzotrifluorideFormula:C7H2BrF5Purity:98%Color and Shape: clear. colourless liquidMolecular weight:260.99g/mol



