CAS 156270-06-3
:1H-Pyrrolo[2,3-B]Pyridine-3-Carboxylic acid
Description:
1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its polarity and solubility in polar solvents. It typically exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases. The presence of the carboxylic acid group allows for potential participation in various chemical reactions, such as esterification or amidation. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the design of novel therapeutic agents. The compound's molecular interactions, including hydrogen bonding and π-π stacking due to its aromatic nature, can influence its reactivity and biological activity. Overall, 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H6N2O2
InChI:InChI=1/C8H6N2O2/c11-8(12)6-4-10-7-5(6)2-1-3-9-7/h1-4H,(H,9,10)(H,11,12)
SMILES:c1cc2c(c[nH]c2nc1)C(=O)O
Synonyms:- 7-Azaindole-3-Carboxylic acid
- Methyl 7-azaindole-3-carboxylic acid
- 7-azaindole-3-carboxylic ...
- 1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 3-Carboxy-1H-pyrrolo[2,3-b]pyridine
- 1H-pyrrolo[2,3-b]pyridine-3-carbo×ylic acid
- 7-Azaindole-3-carboxylic acid 95%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Azaindole-3-carboxylic acid, 95%
CAS:7-Azaindole-3-carboxylic acid is a reactant for synthesis of azaindol derivatives as new acrosin inhibitors and for preparation of triazoles via regioselective heterocyclizaiton reactions. It is also a reactant for synthesis of azaindolylcarboxy-endo-tropanamide. This Thermo Scientific Chemicals br
Formula:C8H6N2O2Purity:95%Molecular weight:162.151H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid
CAS:Formula:C8H6N2O2Purity:97%Color and Shape:SolidMolecular weight:162.14547-Azaindole-3-carboxylic acid
CAS:7-Azaindole-3-carboxylic acid
Purity:97%Color and Shape:SolidMolecular weight:162.15g/mol1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid
CAS:Formula:C8H6N2O2Purity:98%Color and Shape:Solid, White powderMolecular weight:162.1487-Azaindole-3-carboxylic acid
CAS:7-Azaindole-3-carboxylic acid is a useful organic compound for research related to life sciences. The catalog number is T67135 and the CAS number is 156270-06-3.Formula:C8H6N2O2Color and Shape:SolidMolecular weight:162.148




