CAS 156271-23-7: 2',4'-dinitrophenyl 2-deoxy-2-fluoro-beta-xylobioside
Description:2',4'-Dinitrophenyl 2-deoxy-2-fluoro-beta-xylobioside is a synthetic compound that belongs to the class of glycosides, specifically a modified sugar derivative. This compound features a dinitrophenyl group, which is known for its use in various biochemical applications, including as a labeling agent in immunoassays. The presence of the 2-deoxy-2-fluoro modification indicates that the sugar moiety has been altered to enhance its stability and potentially its biological activity. The xylobioside structure suggests that it is composed of two xylose units linked together, which may influence its interaction with enzymes and receptors. This compound is typically used in research settings, particularly in studies related to carbohydrate chemistry and glycosylation processes. Its unique structural characteristics may also make it a valuable tool in the development of glycosylation inhibitors or in the study of glycan-related biological functions. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity associated with the dinitrophenyl group.
Formula:C16H19FN2O12
InChI:InChI=1/C16H19FN2O12/c17-11-13(22)10(31-16-14(23)12(21)8(20)4-28-16)5-29-15(11)30-9-2-1-6(18(24)25)3-7(9)19(26)27/h1-3,8,10-16,20-23H,4-5H2/t8-,10-,11-,12+,13+,14-,15+,16+/m1/s1
- Synonyms:
- Dnp2FXb
- 2,4-dinitrophenyl 2-deoxy-2-fluoro-4-O-beta-D-xylopyranosyl-beta-D-xylopyranoside
- 2',4'-Dinitrophenyl 2-deoxy-2-fluoro-beta-xylobioside
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-xylobioside REF: 3D-ED31393CAS: 156271-23-7 | Min. 95% | 3,037.00 € | Thu 24 Apr 25 |

2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-xylobioside
Ref: 3D-ED31393
1g | 3,037.00 € |