CAS 15641-58-4: 2,2,3,3-Tetramethylcyclopropanecarboxylic acid
Description:2,2,3,3-Tetramethylcyclopropanecarboxylic acid is a cyclic carboxylic acid characterized by its unique cyclopropane structure, which is heavily substituted with four methyl groups. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of multiple methyl groups enhances its steric hindrance, influencing its reactivity and physical properties. Typically, such compounds exhibit low volatility and may have limited solubility in water due to their hydrophobic nature. The bulky structure can also affect the compound's boiling and melting points, often resulting in higher values compared to less substituted analogs. In terms of applications, derivatives of tetramethylcyclopropanecarboxylic acid may be explored in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's unique structure may provide insights into the study of strain in small ring systems and their reactivity patterns. Overall, 2,2,3,3-Tetramethylcyclopropanecarboxylic acid serves as an interesting subject for both theoretical and practical applications in organic chemistry.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c1-7(2)5(6(9)10)8(7,3)4/h5H,1-4H3,(H,9,10)
InChI key:InChIKey=SFHVXKNMCGSLAR-UHFFFAOYSA-N
SMILES:O=C(O)C1C(C)(C)C1(C)C
- Synonyms:
- 2,2,3,3-Tetramethylcyclopropane-1-carboxylic acid
- 2,2,3,3-Tetramethylcyclopropylcarboxylic acid
- Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-
- Fenpropatheric acid
- 2,2,3,3-Tetramethylcyclopropanecarboxylic acid
