CymitQuimica logo

CAS 156428-81-8

:

Boronic acid, (4-formyl-2-methylphenyl)-

Description:
Boronic acid, (4-formyl-2-methylphenyl)-, also known by its CAS number 156428-81-8, is an organic compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring that features both a formyl group (-CHO) and a methyl group (-CH3) at specific positions. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the formyl group suggests potential reactivity in condensation reactions, while the methyl group can influence the compound's solubility and steric properties. Boronic acids are also known for their role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in organic chemistry. Overall, this compound's unique structure and functional groups contribute to its versatility in chemical reactions and applications in medicinal chemistry and polymer science.
Formula:C8H9BO3
InChI:InChI=1S/C8H9BO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-5,11-12H,1H3
InChI key:ORHODDYPZMCLBU-UHFFFAOYSA-N
SMILES:B(C1=C(C=C(C=C1)C=O)C)(O)O
Found 4 products.