CAS 15644-82-3
:2,6-Dimethyl-4-hydroxyquinoline
Description:
2,6-Dimethyl-4-hydroxyquinoline, with the CAS number 15644-82-3, is an organic compound belonging to the quinoline family. It features a quinoline backbone, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of two methyl groups at the 2 and 6 positions and a hydroxyl group at the 4 position contributes to its unique chemical properties. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in organic solvents. It is known for its potential applications in various fields, including pharmaceuticals and as a chemical intermediate. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, 2,6-Dimethyl-4-hydroxyquinoline may exhibit antioxidant properties, making it of interest in studies related to oxidative stress and related health implications. Its synthesis and characterization are of interest in organic chemistry, particularly in the development of new materials and bioactive compounds.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-7-3-4-10-9(5-7)11(13)6-8(2)12-10/h3-6H,1-2H3,(H,12,13)
SMILES:Cc1ccc2c(c1)c(=O)cc(C)[nH]2
Synonyms:- 2,6-dimethylquinolin-4(1H)-one
- 2,6-Dimethyl-4-Quinolinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Quinolinol, 2,6-dimethyl-
CAS:Formula:C11H11NOPurity:97%Color and Shape:SolidMolecular weight:173.21112,6-Dimethyl-4-hydroxyquinoline
CAS:2,6-Dimethyl-4-hydroxyquinolinePurity:≥95%Color and Shape:Grey PowderMolecular weight:173.21g/mol2,6-Dimethyl-4-hydroxyquinoline
CAS:2,6-Dimethyl-4-hydroxyquinoline is a phthalocyanine that has been shown to be reduced by electrochemical reactions. 2,6-Dimethyl-4-hydroxyquinoline has been shown to have redox properties in the cyclic voltammetry and square reduction process. This compound can be characterized using spectroscopy and elemental analysis. Mass spectroscopy is used to identify the molecular weight of the compound. The elemental composition of 2,6-dimethyl-4-hydroxyquinoline is C 8 H 8 N 4 O 3 . It can be synthesized from phthalonitrile and formaldehyde with a chemical reaction that yields an elemental composition of C 6 H 6 + C 8 H 8 N 4 O 3 .Formula:C11H11NOPurity:Min. 95%Molecular weight:173.21 g/mol



