CAS 156458-94-5
:(5E)-5-(3-Bromopropylidene)-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one
Description:
(5E)-5-(3-Bromopropylidene)-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a dibenzo[a,d]cycloheptene framework and a ketone functional group. The presence of the bromopropylidene substituent introduces notable reactivity and influences the compound's physical properties, such as solubility and boiling point. This compound is likely to exhibit interesting chemical behavior due to the conjugated system formed by the double bonds and the aromatic rings, which can contribute to its stability and potential for undergoing electrophilic or nucleophilic reactions. Additionally, the stereochemistry indicated by the (5E) configuration suggests specific spatial arrangements that may affect its biological activity and interactions with other molecules. Overall, this compound's structural features make it a subject of interest in organic synthesis and medicinal chemistry, where it may serve as a precursor or a lead compound for further development.
Formula:C18H15BrO
InChI:InChI=1S/C18H15BrO/c19-11-5-10-15-14-7-2-1-6-13(14)12-18(20)17-9-4-3-8-16(15)17/h1-4,6-10H,5,11-12H2/b15-10+
InChI key:InChIKey=QVIBQLAUHHKJDM-XNTDXEJSSA-N
SMILES:C(\CCBr)=C\1/C=2C(C(=O)CC=3C1=CC=CC3)=CC=CC2
Synonyms:- (5E)-5-(3-Bromopropylidene)-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one
- 10H-Dibenzo[a,d]cyclohepten-10-one, 5-(3-bromopropylidene)-5,11-dihydro-, (E)-
- 10H-Dibenzo[a,d]cyclohepten-10-one, 5-(3-bromopropylidene)-5,11-dihydro-, (5E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5E)-5-(3-Bromopropylidene)-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one
CAS:Controlled ProductApplications (5E)-5-(3-Bromopropylidene)-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one is an intermediate in the synthesis of 10-Hydroxy (E)-Amitriptyline (D462790). (5E)-5-[3-(dimethylamino)propylidene]-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol is a metabolite of amitriptyline (A633350) which is a dibenzocycloheptadiene derivative and an antidepressant (1). Amitriptyline is also a TrkA and TrkB receptor agonist and exhibits neurotrophic and anti-inflammatory activities (2,3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA).
Formula:C18H15BrOColor and Shape:NeatMolecular weight:327.22
