CAS 156458-95-6

(5E)-5-(3-Bromopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol

Description:

(5E)-5-(3-Bromopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol is a complex organic compound characterized by its unique bicyclic structure, which incorporates a dibenzo[a,d]cycloheptene framework. This compound features a bromopropylidene substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of a hydroxyl group (alcohol functional group) at the 10-position enhances its polarity and solubility in polar solvents, influencing its interactions in biological systems. The compound's stereochemistry, indicated by the (5E) configuration, suggests specific spatial arrangements that can affect its biological activity and reactivity. Additionally, the bromine atom introduces a halogen, which can participate in various chemical reactions, such as nucleophilic substitutions. Overall, this compound's structural features suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research into its biological properties and reactivity.

Formula: C₁₈H₁₇BrO

InChI: InChI=1/C18H17BrO/c19-11-5-10-15-14-7-2-1-6-13(14)12-18(20)17-9-4-3-8-16(15)17/h1-4,6-10,18,20H,5,11-12H2/b15-10+

InChI key: InChIKey=KNGHLHQCMDBTQE-XNTDXEJSNA-N

SMILES: C(\CCBr)=C\1/C=2C(C(O)CC=3C1=CC=CC3)=CC=CC2

Synonyms:

• (5E)-5-(3-Bromopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol
• 5H-Dibenzo[a,d]cyclohepten-10-ol, 5-(3-bromopropylidene)-10,11-dihydro-, (E)-
• 5H-dibenzo[a,d]cyclohepten-10-ol, 5-(3-bromopropylidene)-10,11-dihydro-, (5E)-

(5E)-5-(3-Bromopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol

Controlled Product

CAS: 156458-95-6

Applications (5E)-5-(3-Bromopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol is an intermediate in the synthesis of 10-Hydroxy (E)-Amitriptyline (D462790). (5E)-5-[3-(dimethylamino)propylidene]-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol is a metabolite of amitriptyline (A633350) which is a dibenzocycloheptadiene derivative and an antidepressant (1). Amitriptyline is also a TrkA and TrkB receptor agonist and exhibits neurotrophic and anti-inflammatory activities (2,3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA).

Formula: C₁₈H₁₇BrO

Color and Shape: Neat

Molecular weight: 329.23

Ref: TR-B471365