CAS 156467-85-5
:A-conotoxin im I
Description:
A-conotoxin Im I is a peptide derived from the venom of cone snails, specifically from the species Conus imperialis. This neurotoxic compound is characterized by its ability to selectively inhibit certain types of nicotinic acetylcholine receptors, which are crucial for neurotransmission in the nervous system. A-conotoxin Im I consists of a relatively small chain of amino acids, typically exhibiting a high degree of structural stability due to the presence of disulfide bonds. Its specificity and potency make it a valuable tool in neuropharmacology and a potential candidate for therapeutic applications, particularly in pain management and neurological disorders. The compound's mechanism of action involves blocking synaptic transmission, which can lead to paralysis in prey, showcasing its effectiveness as a neurotoxin. Research into A-conotoxin Im I continues to explore its potential uses in drug development, particularly in designing novel analgesics that target specific receptor subtypes without the side effects associated with traditional pain medications.
Formula:C52H82N20O15S4
InChI:InChI=1/C52H82N20O15S4/c1-24(41(78)66-30(15-25-18-61-27-8-3-2-7-26(25)27)44(81)64-28(9-4-12-59-51(55)56)42(79)69-33(20-88)40(54)77)62-46(83)35(22-90)70-43(80)29(10-5-13-60-52(57)58)65-49(86)37-11-6-14-72(37)50(87)31(16-39(75)76)67-45(82)32(19-73)68-48(85)36(23-91)71-47(84)34(21-89)63-38(74)17-53/h2-3,7-8,18,24,28-37,61,73,88-91H,4-6,9-17,19-23,53H2,1H3,(H2,54,77)(H,62,83)(H,63,74)(H,64,81)(H,65,86)(H,66,78)(H,67,82)(H,68,85)(H,69,79)(H,70,80)(H,71,84)(H,75,76)(H4,55,56,59)(H4,57,58,60)/t24-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-/m0/s1
SMILES:C[C@@H](C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CS)C(=N)O)O)O)O)N=C([C@H](CS)N=C([C@H](CCCNC(=N)N)N=C([C@@H]1CCCN1C(=O)[C@H](CC(=O)O)N=C([C@H](CO)N=C([C@H](CS)N=C([C@H](CS)N=C(CN)O)O)O)O)O)O)O
Synonyms:- a-Conotoxin IMI, Conus imperialis
- H-Gly-Cys-Cys-Ser-Asp-Pro-Arg-Cys-Ala-Trp-Arg-Cys-NH2 (Disulfide bonds between Cys2 and Cys8/Cys3 and Cys12)
- glycyl-L-cysteinyl-L-cysteinyl-L-seryl-L-alpha-aspartyl-L-prolyl-N~5~-(diaminomethylidene)-L-ornithyl-L-cysteinyl-L-alanyl-L-tryptophyl-N~5~-(diaminomethylidene)-L-ornithyl-L-cysteinamide
- Alpha-Conotoxin Imi
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-Conotoxin imi
CAS:alpha-Conotoxin imi is a nicotinic acetylcholine receptor ligand.Formula:C52H78N20O15S4Purity:98%Color and Shape:SolidMolecular weight:1351.56Alpha-Conotoxin ImI
CAS:Alpha-conotoxin ImI is a peptide that belongs to the class of alpha-conotoxins. It is an activator of nicotinic acetylcholine receptors, which inhibit voltage-gated calcium channels. The high purity of this product allows for its use in research and development. Alpha-conotoxin ImI has been used to study protein interactions and receptor pharmacology.Formula:C52H78N20O15S4Purity:Min. 95%Molecular weight:1,351.6 g/mola-Conotoxin IMI
CAS:Controlled Productα7 nAChR selective blocker
Formula:C52H78N20O15S4Purity:Min. 95%Molecular weight:1,347.53 g/molRef: 3D-FC73334
Discontinued product

