CAS 15648-86-9: Myricetin 3-O-galactoside
Description:Myricetin 3-O-galactoside is a flavonoid glycoside, a type of compound that combines a flavonoid (myricetin) with a sugar moiety (galactose). It is characterized by its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anticancer effects. This compound is typically found in various plants, particularly in fruits and vegetables, and is known for its role in plant pigmentation and UV protection. Myricetin itself is a well-studied flavonoid, recognized for its ability to scavenge free radicals and modulate various biological pathways. The glycosylation at the 3-position enhances its solubility and bioavailability, making it more effective in biological systems. Myricetin 3-O-galactoside may also exhibit various pharmacological activities, although further research is necessary to fully elucidate its mechanisms and therapeutic potential. Its CAS number, 15648-86-9, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases.
Formula:C21H20O13
InChI:InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15+,17+,18-,21+/m1/s1
InChI key:InChIKey=FOHXFLPXBUAOJM-MGMURXEASA-N
SMILES:O=C1C(OC2OC(CO)C(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=C(O)C(O)=C(O)C4
- Synonyms:
- Myricetin 3-β-D-galactoside
- 3-(β-D-Galactopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
- Galactopyranoside, 5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-3-yl, β-D-
- Flavone, 3,3′,4′,5,5′,7-hexahydroxy-, 3-β-D-galactopyranoside
- 4H-1-Benzopyran-4-one, 3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-
