CAS 1565-51-1

3-AMINO-4-BUTYLAMINO-BENZENESULFONAMIDE

Description:

3-Amino-4-butylamino-benzenesulfonamide, also known by its CAS number 1565-51-1, is an organic compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group (-SO2NH2) attached to a benzene ring, which is further substituted with amino groups. The presence of both amino and butylamino groups contributes to its potential as a versatile building block in medicinal chemistry. It is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the presence of amino groups. The compound may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its structural features suggest potential interactions with biological systems, which could be explored for therapeutic applications. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₇N₃O₂S

InChI: InChI=1/C10H17N3O2S/c1-2-3-6-13-10-5-4-8(7-9(10)11)16(12,14)15/h4-5,7,13H,2-3,6,11H2,1H3,(H2,12,14,15)

SMILES: CCCCNc1ccc(cc1N)S(=O)(=O)N

Synonyms:

• Benzenesulfonamide, 3-Amino-4-(Butylamino)-

3-Amino-4-butylamino-benzenesulfonamide

CAS: 1565-51-1

Formula: C₁₀H₁₇N₃O₂S

Molecular weight: 243.3259

Ref: IN-DA001OS3

3-Amino-4-(butylamino)benzene-1-sulfonamide

CAS: 1565-51-1

Versatile small molecule scaffold

Formula: C₁₀H₁₇N₃O₂S

Purity: Min. 95%

Molecular weight: 243.33 g/mol

Ref: 3D-BAA56551