CAS 1565-90-8

4-Fluoro-3-(2-furyl)acrylophenone

Description:

4-Fluoro-3-(2-furyl)acrylophenone, with the CAS number 1565-90-8, is an organic compound characterized by its unique structural features, including a fluorine atom and a furan ring. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. It possesses a conjugated system that contributes to its electronic properties, making it useful in photochemical reactions. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its reactivity, while the furan moiety can participate in various chemical transformations. Additionally, 4-Fluoro-3-(2-furyl)acrylophenone may exhibit interesting optical properties, making it a candidate for studies in materials science and photonics. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₃H₉FO₂

InChI: InChI=1/C13H9FO2/c14-11-5-3-10(4-6-11)13(15)8-7-12-2-1-9-16-12/h1-9H

SMILES: c1cc(C=CC(=O)c2ccc(cc2)F)oc1

Synonyms:

• Acrylophenone, 4'-fluoro-3-(2-furyl)-
• 1-[4-Fluoro-3-(Furan-2-Yl)Phenyl]Prop-2-En-1-One
• 1-(4-Fluorophenyl)-3-(Furan-2-Yl)Prop-2-En-1-One

1-(4-Fluorophenyl)-3-(furan-2-yl)prop-2-en-1-one

CAS: 1565-90-8

Formula: C₁₃H₉FO₂

Molecular weight: 216.2078

Ref: IN-DA001ORV

1-(4-Fluorophenyl)-3-(2-furyl)prop-2-en-1-one

CAS: 1565-90-8

1-(4-Fluorophenyl)-3-(2-furyl)prop-2-en-1-one

Purity: ≥95%

Molecular weight: 216.21g/mol

Ref: 54-PC31954

(2E)-1-(4-fluorophenyl)-3-(furan-2-yl)prop-2-en-1-one

CAS: 1565-90-8

Formula: C₁₃H₉FO₂

Purity: 95.0%

Molecular weight: 216.211

Ref: 10-F523835