
CAS 156543-00-9
:1,2-Distearoyl-sn-glycero-3-phosphoethanolamine-N-carboxy(polyethylene glycol)
Description:
1,2-Distearoyl-sn-glycero-3-phosphoethanolamine-N-carboxy(polyethylene glycol), commonly referred to as DSPE-PEG, is a phospholipid derivative that features a hydrophobic tail composed of two stearic acid chains and a hydrophilic head group containing polyethylene glycol (PEG). This amphiphilic nature allows it to form stable lipid bilayers and micelles, making it particularly useful in drug delivery systems and nanomedicine. The PEG component enhances solubility in aqueous environments and provides a steric barrier that can reduce protein adsorption and improve circulation time in biological systems. DSPE-PEG is often utilized in the formulation of liposomes and nanoparticles for targeted drug delivery, as it can facilitate the incorporation of therapeutic agents and improve their bioavailability. Additionally, the carboxylic acid group in the structure allows for further functionalization, enabling conjugation with various biomolecules for specific targeting applications. Overall, DSPE-PEG is a versatile compound widely used in pharmaceutical and biomedical research.
Formula:(C2H4O)nC43H84NO10P
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-methoxy-
- Poly(oxy-1,2-ethanediyl), α-[6-hydroxy-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-methoxy-, P-oxide, (R)-
- 1,2-Distearoyl-sn-glycero-3-phosphoethanolamine-N-carboxy(polyethylene glycol)
- MPEG-DSPE
- Poly(oxy-1,2-ethanediyl), α-[6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-methoxy-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DSPE-mPEG-2000
CAS:DSPE-mPEG-2000, a PEG-based phospholipid, facilitates the synthesis of liposomes for cancer agent delivery [1] [2].Formula:C45H88NO11PColor and Shape:SolidMolecular weight:849.6095

