CAS 156547-56-7

FSCPX

Description:

FSCPX, with the CAS number 156547-56-7, is a chemical compound that belongs to the class of fluorinated compounds. It is primarily recognized for its application in various industrial and research settings, particularly in the field of materials science and pharmaceuticals. FSCPX exhibits unique properties due to the presence of fluorine atoms, which can enhance its stability, lipophilicity, and reactivity compared to non-fluorinated analogs. The compound may also demonstrate specific interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure typically includes a combination of carbon, fluorine, and other elements, contributing to its distinctive characteristics. Safety data sheets and regulatory information should be consulted for handling and usage guidelines, as fluorinated compounds can pose environmental and health risks. Overall, FSCPX represents a significant compound in the realm of synthetic chemistry, with potential applications that warrant further exploration and study.

Formula: C₂₃H₂₇FN₄O₆S

InChI: InChI=1/C23H27FN4O6S/c1-2-12-28-21(29)18-20(26-19(25-18)15-6-3-4-7-15)27(23(28)31)13-5-14-34-22(30)16-8-10-17(11-9-16)35(24,32)33/h8-11,15H,2-7,12-14H2,1H3,(H,25,26)

SMILES: CCCn1c(=O)c2c([nH]c(C3CCCC3)n2)n(CCCOC(=O)c2ccc(cc2)S(=O)(=O)F)c1=O

Synonyms:

• 8-Cyclopentyl-3-(3-((4-(Fluorosulfonyl)Benzoyl)Oxy)Propyl)-1-Propylxanthine
• 3-(8-cyclopentyl-2,6-dioxo-1-propyl-1,2,6,7-tetrahydro-3H-purin-3-yl)propyl 4-(fluorosulfonyl)benzoate

Benzoic acid, 4-(fluorosulfonyl)-, 3-(8-cyclopentyl-1,2,6,9-tetrahydro-2,6-dioxo-1-propyl-3H-purin-3-yl)propyl ester

CAS: 156547-56-7

Formula: C₂₃H₂₇FN₄O₆S

Purity: 95%

Molecular weight: 506.5471

Ref: IN-DA001OSD

FSCPX

CAS: 156547-56-7

FSCPX

Purity: ≥98%

Molecular weight: 506.55g/mol

Ref: 54-BUP02930

FSCPX

CAS: 156547-56-7

FSCPX is a potent and selective irreversible antagonist of the A1 adenosine receptor (A1AR), exhibiting low nanomolar binding potency.

Formula: C₂₃H₂₇FN₄O₆S

Purity: 99.4%

Color and Shape: Solid

Molecular weight: 506.55

Ref: TM-T39039