CAS 1565827-87-3
:7-(2-Hydroxyethyl)-2(3H)-benzoxazolone
Description:
7-(2-Hydroxyethyl)-2(3H)-benzoxazolone, identified by its CAS number 1565827-87-3, is a chemical compound characterized by its benzoxazolone structure, which features a fused benzene and oxazolone ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyethyl group, which enhances its hydrophilicity. The hydroxyl group can also participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the benzoxazolone moiety is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to undergo chemical transformations and serve as a building block for more complex structures. The compound may also exhibit fluorescence properties, making it useful in analytical chemistry and as a dye. Overall, 7-(2-Hydroxyethyl)-2(3H)-benzoxazolone is a versatile compound with significant potential for research and application in various chemical contexts.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c11-5-4-6-2-1-3-7-8(6)13-9(12)10-7/h1-3,11H,4-5H2,(H,10,12)
InChI key:InChIKey=BSPDFQNBUWGQRE-UHFFFAOYSA-N
SMILES:C(CO)C1=C2C(NC(=O)O2)=CC=C1
Synonyms:- 7-(2-Hydroxyethyl)-2(3H)-benzoxazolone
- 2(3H)-Benzoxazolone, 7-(2-hydroxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-(2-Hydroxyethyl)-2,3-dihydro-1,3-benzoxazol-2-one
CAS:7-(2-Hydroxyethyl)-2,3-dihydro-1,3-benzoxazol-2-one
Molecular weight:179.17g/mol
