CAS 1565845-72-8

Benzenamine, 2-chloro-4-(2-furanyl)-6-methyl-, hydrochloride (1:1)

Description:

Benzenamine, 2-chloro-4-(2-furanyl)-6-methyl-, hydrochloride (1:1), also known by its CAS number 1565845-72-8, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a chloro group, a furan moiety, and a methyl group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for handling. This compound exhibits properties typical of aromatic amines, such as potential reactivity in electrophilic substitution reactions and the ability to form hydrogen bonds due to the amine functional group. Its furan ring contributes to its unique electronic properties and may influence its biological activity. The compound's specific applications and safety profile would depend on its chemical behavior, including toxicity and reactivity, which should be assessed in a laboratory setting. As with many chemical substances, proper handling and safety precautions are essential due to potential health risks associated with amines and halogenated compounds.

Formula: C₁₁H₁₀ClNO·ClH

InChI: InChI=1S/C11H10ClNO.ClH/c1-7-5-8(6-9(12)11(7)13)10-3-2-4-14-10;/h2-6H,13H2,1H3;1H

InChI key: InChIKey=PLWHRAISABZNAP-UHFFFAOYSA-N

SMILES: CC=1C=C(C=C(Cl)C1N)C2=CC=CO2.Cl

Synonyms:

• Benzenamine, 2-chloro-4-(2-furanyl)-6-methyl-, hydrochloride (1:1)

2-Chloro-4-(furan-2-yl)-6-methylaniline hydrochloride

CAS: 1565845-72-8

2-Chloro-4-(furan-2-yl)-6-methylaniline hydrochloride

Purity: 95%

Molecular weight: 244.12g/mol

Ref: 54-OR310510